C13H15F3N2O3S2 — CID 47079939
N-cyclopropyl-2-[methyl-[4-(trifluoromethylsulfanyl)phenyl]sulfonylamino]acetamide (PubChem CID 47079939) has the molecular formula C13H15F3N2O3S2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-cyclopropyl-2-[methyl-[4-(trifluoromethylsulfanyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[methyl-[4-(trifluoromethylsulfanyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 47079939 |
| Molecular Formula | C13H15F3N2O3S2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-cyclopropyl-2-[methyl-[4-(trifluoromethylsulfanyl)phenyl]sulfonylamino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)S(=O)(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O3S2/c1-18(8-12(19)17-9-2-3-9)23(20,21)11-6-4-10(5-7-11)22-13(14,15)16/h4-7,9H,2-3,8H2,1H3,(H,17,19) |
| InChIKey | CIJFPZXOPBTORY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |