C12H16BrN3O3S — CID 62057270
2-[(4-amino-3-bromophenyl)sulfonyl-methylamino]-N-cyclopropylacetamide (PubChem CID 62057270) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-[(4-amino-3-bromophenyl)sulfonyl-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[(4-amino-3-bromophenyl)sulfonyl-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 62057270 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[(4-amino-3-bromophenyl)sulfonyl-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CC(=O)NC1CC1)S(=O)(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3O3S/c1-16(7-12(17)15-8-2-3-8)20(18,19)9-4-5-11(14)10(13)6-9/h4-6,8H,2-3,7,14H2,1H3,(H,15,17) |
| InChIKey | PVNFDGWFKFHPIN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|