C12H23ClN2O — CID 120599149
2-cyclobutyl-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride (PubChem CID 120599149) has the molecular formula C12H23ClN2O and a molecular weight of 246.78 g/mol. Its IUPAC name is 2-cyclobutyl-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride.
| Compound Name | 2-cyclobutyl-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120599149 |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-cyclobutyl-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
| SMILES | CC1CC(NC(=O)CC2CCC2)CCN1.Cl |
| InChI | InChI=1S/C12H22N2O.ClH/c1-9-7-11(5-6-13-9)14-12(15)8-10-3-2-4-10;/h9-11,13H,2-8H2,1H3,(H,14,15);1H |
| InChIKey | ZUDVYWGUQUGGOO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |