[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid

C7H14N2O2 — CID 146485805

IUPAC[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid
SMILESC[C@@H]1C[C@H](NC(=O)O)CCN1
InChIInChI=1S/C7H14N2O2/c1-5-4-6(2-3-8-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6-/m1/s1
InChIKeyOUPISTWRBVJQEZ-PHDIDXHHSA-N
MW158.20 g/mol
LogP0.39
Rot. Bonds1

About [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid

[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid (PubChem CID 146485805) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid.

Molecular Properties

Compound Name[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid
PubChem CID146485805
Molecular FormulaC7H14N2O2
Molecular Weight158.20 g/mol
Exact Mass158.11
IUPAC Name[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid
SMILESC[C@@H]1C[C@H](NC(=O)O)CCN1
InChIInChI=1S/C7H14N2O2/c1-5-4-6(2-3-8-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6-/m1/s1
InChIKeyOUPISTWRBVJQEZ-PHDIDXHHSA-N
XLogP0.39
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid?
The IUPAC name of [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid (CID 146485805) is [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid.
What is the SMILES notation for [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid?
The canonical SMILES for [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid is C[C@@H]1C[C@H](NC(=O)O)CCN1.
What is the InChIKey of [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid?
The InChIKey is OUPISTWRBVJQEZ-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-5-4-6(2-3-8-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6-/m1/s1.
What are the key properties of [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid?
[(2R,4R)-2-methylpiperidin-4-yl]carbamic acid has a molecular weight of 158.20 g/mol, XLogP of 0.39, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-2-methylpiperidin-4-yl]carbamic acid is sourced from PubChem (CID 146485805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).