C15H29ClN4O2 — CID 120597978
2-(cyclohexylcarbamoylamino)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride (PubChem CID 120597978) has the molecular formula C15H29ClN4O2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride.
| Compound Name | 2-(cyclohexylcarbamoylamino)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120597978 |
| Molecular Formula | C15H29ClN4O2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
| SMILES | CC1CC(NC(=O)CNC(=O)NC2CCCCC2)CCN1.Cl |
| InChI | InChI=1S/C15H28N4O2.ClH/c1-11-9-13(7-8-16-11)18-14(20)10-17-15(21)19-12-5-3-2-4-6-12;/h11-13,16H,2-10H2,1H3,(H,18,20)(H2,17,19,21);1H |
| InChIKey | XDTYFRPGXGFILW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |