C10H23N3O4S — CID 104873870
N'-hydroxy-2,2-dimethyl-3-(2-propan-2-yloxyethylsulfonylamino)propanimidamide (PubChem CID 104873870) has the molecular formula C10H23N3O4S and a molecular weight of 281.38 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-3-(2-propan-2-yloxyethylsulfonylamino)propanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-3-(2-propan-2-yloxyethylsulfonylamino)propanimidamide |
|---|---|
| PubChem CID | 104873870 |
| Molecular Formula | C10H23N3O4S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-3-(2-propan-2-yloxyethylsulfonylamino)propanimidamide |
| SMILES | CC(C)OCCS(=O)(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H23N3O4S/c1-8(2)17-5-6-18(15,16)12-7-10(3,4)9(11)13-14/h8,12,14H,5-7H2,1-4H3,(H2,11,13) |
| InChIKey | FVWRLYIWTSUUEF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|