C6H13F2N3O3S — CID 104873880
3-(difluoromethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide (PubChem CID 104873880) has the molecular formula C6H13F2N3O3S and a molecular weight of 245.25 g/mol. Its IUPAC name is 3-(difluoromethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide.
| Compound Name | 3-(difluoromethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104873880 |
| Molecular Formula | C6H13F2N3O3S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-(difluoromethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(CNS(=O)(=O)C(F)F)C(N)=NO |
| InChI | InChI=1S/C6H13F2N3O3S/c1-6(2,4(9)11-12)3-10-15(13,14)5(7)8/h5,10,12H,3H2,1-2H3,(H2,9,11) |
| InChIKey | BPVIFKWGUCORPK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|