C9H17N5O3S — CID 104873854
N'-hydroxy-2,2-dimethyl-3-[(1-methylimidazol-4-yl)sulfonylamino]propanimidamide (PubChem CID 104873854) has the molecular formula C9H17N5O3S and a molecular weight of 275.33 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-3-[(1-methylimidazol-4-yl)sulfonylamino]propanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-3-[(1-methylimidazol-4-yl)sulfonylamino]propanimidamide |
|---|---|
| PubChem CID | 104873854 |
| Molecular Formula | C9H17N5O3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-3-[(1-methylimidazol-4-yl)sulfonylamino]propanimidamide |
| SMILES | Cn1cnc(S(=O)(=O)NCC(C)(C)C(N)=NO)c1 |
| InChI | InChI=1S/C9H17N5O3S/c1-9(2,8(10)13-15)5-12-18(16,17)7-4-14(3)6-11-7/h4,6,12,15H,5H2,1-3H3,(H2,10,13) |
| InChIKey | VRDDCIGJUONNHC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|