C10H20N4O3S — CID 103838100
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide (PubChem CID 103838100) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103838100 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C10H20N4O3S/c1-10(15,7-13(2)3)6-12-18(16,17)9-5-14(4)8-11-9/h5,8,12,15H,6-7H2,1-4H3 |
| InChIKey | WPSJYORFRHLMTR-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |