C10H19ClN4O3S — CID 103838093
5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide (PubChem CID 103838093) has the molecular formula C10H19ClN4O3S and a molecular weight of 310.81 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103838093 |
| Molecular Formula | C10H19ClN4O3S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C10H19ClN4O3S/c1-10(16,6-14(2)3)5-13-19(17,18)9-8(11)15(4)7-12-9/h7,13,16H,5-6H2,1-4H3 |
| InChIKey | GVYGFTMPNHLUNW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |