C9H16ClN3O3S — CID 107271238
5-chloro-N-(4-hydroxypentyl)-1-methylimidazole-4-sulfonamide (PubChem CID 107271238) has the molecular formula C9H16ClN3O3S and a molecular weight of 281.76 g/mol. Its IUPAC name is 5-chloro-N-(4-hydroxypentyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(4-hydroxypentyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 107271238 |
| Molecular Formula | C9H16ClN3O3S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-chloro-N-(4-hydroxypentyl)-1-methylimidazole-4-sulfonamide |
| SMILES | CC(O)CCCNS(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C9H16ClN3O3S/c1-7(14)4-3-5-12-17(15,16)9-8(10)13(2)6-11-9/h6-7,12,14H,3-5H2,1-2H3 |
| InChIKey | REASEPCRVMZTHP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|