C8H12ClN3O4S — CID 60745024
methyl 3-[(5-chloro-1-methylimidazol-4-yl)sulfonylamino]propanoate (PubChem CID 60745024) has the molecular formula C8H12ClN3O4S and a molecular weight of 281.72 g/mol. Its IUPAC name is methyl 3-[(5-chloro-1-methylimidazol-4-yl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(5-chloro-1-methylimidazol-4-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 60745024 |
| Molecular Formula | C8H12ClN3O4S |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | methyl 3-[(5-chloro-1-methylimidazol-4-yl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C8H12ClN3O4S/c1-12-5-10-8(7(12)9)17(14,15)11-4-3-6(13)16-2/h5,11H,3-4H2,1-2H3 |
| InChIKey | VIOHLFVLZBDOEU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |