C10H14ClN3O6S — CID 62957497
methyl 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 62957497) has the molecular formula C10H14ClN3O6S and a molecular weight of 339.76 g/mol. Its IUPAC name is methyl 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 62957497 |
| Molecular Formula | C10H14ClN3O6S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | methyl 2-[(5-chloro-1-methylimidazol-4-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C10H14ClN3O6S/c1-13-6-12-10(9(13)11)21(17,18)14(4-7(15)19-2)5-8(16)20-3/h6H,4-5H2,1-3H3 |
| InChIKey | DVOILLVSKGBQFE-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |