C14H26ClN3O2S — CID 61047067
5-chloro-1-methyl-N,N-dipentylimidazole-4-sulfonamide (PubChem CID 61047067) has the molecular formula C14H26ClN3O2S and a molecular weight of 335.90 g/mol. Its IUPAC name is 5-chloro-1-methyl-N,N-dipentylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N,N-dipentylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 61047067 |
| Molecular Formula | C14H26ClN3O2S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-chloro-1-methyl-N,N-dipentylimidazole-4-sulfonamide |
| SMILES | CCCCCN(CCCCC)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C14H26ClN3O2S/c1-4-6-8-10-18(11-9-7-5-2)21(19,20)14-13(15)17(3)12-16-14/h12H,4-11H2,1-3H3 |
| InChIKey | KGWCRLUHCHUWAJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|