C7H12ClN3O2S — CID 43456033
5-chloro-N-ethyl-N,1-dimethylimidazole-4-sulfonamide (PubChem CID 43456033) has the molecular formula C7H12ClN3O2S and a molecular weight of 237.71 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N,1-dimethylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-ethyl-N,1-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 43456033 |
| Molecular Formula | C7H12ClN3O2S |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 5-chloro-N-ethyl-N,1-dimethylimidazole-4-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C7H12ClN3O2S/c1-4-11(3)14(12,13)7-6(8)10(2)5-9-7/h5H,4H2,1-3H3 |
| InChIKey | PSKNFIUKWQLBRX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |