C9H14ClN3O2S — CID 115650724
5-chloro-N-cyclobutyl-N,1-dimethylimidazole-4-sulfonamide (PubChem CID 115650724) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 5-chloro-N-cyclobutyl-N,1-dimethylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-cyclobutyl-N,1-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 115650724 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 5-chloro-N-cyclobutyl-N,1-dimethylimidazole-4-sulfonamide |
| SMILES | CN(C1CCC1)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C9H14ClN3O2S/c1-12-6-11-9(8(12)10)16(14,15)13(2)7-4-3-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | PQPIBNUQHOADHN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |