C10H18N4O2S — CID 63978307
5-amino-N-cyclopentyl-N,3-dimethylimidazole-4-sulfonamide (PubChem CID 63978307) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-amino-N-cyclopentyl-N,3-dimethylimidazole-4-sulfonamide.
| Compound Name | 5-amino-N-cyclopentyl-N,3-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 63978307 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-amino-N-cyclopentyl-N,3-dimethylimidazole-4-sulfonamide |
| SMILES | CN(C1CCCC1)S(=O)(=O)c1c(N)ncn1C |
| InChI | InChI=1S/C10H18N4O2S/c1-13-7-12-9(11)10(13)17(15,16)14(2)8-5-3-4-6-8/h7-8H,3-6,11H2,1-2H3 |
| InChIKey | PIKIKJDITNHLOS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |