C9H18N4O2S2 — CID 114236541
5-amino-N,3-dimethyl-N-(3-methylsulfanylpropyl)imidazole-4-sulfonamide (PubChem CID 114236541) has the molecular formula C9H18N4O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-amino-N,3-dimethyl-N-(3-methylsulfanylpropyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-N,3-dimethyl-N-(3-methylsulfanylpropyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114236541 |
| Molecular Formula | C9H18N4O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-amino-N,3-dimethyl-N-(3-methylsulfanylpropyl)imidazole-4-sulfonamide |
| SMILES | CSCCCN(C)S(=O)(=O)c1c(N)ncn1C |
| InChI | InChI=1S/C9H18N4O2S2/c1-12-7-11-8(10)9(12)17(14,15)13(2)5-4-6-16-3/h7H,4-6,10H2,1-3H3 |
| InChIKey | YNPFXBPYBJIDSR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|