C11H19N3O2S2 — CID 114238260
N-methyl-2-(methylamino)-N-(3-methylsulfanylpropyl)pyridine-4-sulfonamide (PubChem CID 114238260) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is N-methyl-2-(methylamino)-N-(3-methylsulfanylpropyl)pyridine-4-sulfonamide.
| Compound Name | N-methyl-2-(methylamino)-N-(3-methylsulfanylpropyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 114238260 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-methyl-2-(methylamino)-N-(3-methylsulfanylpropyl)pyridine-4-sulfonamide |
| SMILES | CNc1cc(S(=O)(=O)N(C)CCCSC)ccn1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-12-11-9-10(5-6-13-11)18(15,16)14(2)7-4-8-17-3/h5-6,9H,4,7-8H2,1-3H3,(H,12,13) |
| InChIKey | ZLYLVSZJDFYCSI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|