C14H19N3O2S2 — CID 115987134
N-methyl-2-(methylamino)-N-(2-methylsulfanylethyl)quinoline-6-sulfonamide (PubChem CID 115987134) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-methyl-2-(methylamino)-N-(2-methylsulfanylethyl)quinoline-6-sulfonamide.
| Compound Name | N-methyl-2-(methylamino)-N-(2-methylsulfanylethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 115987134 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-methyl-2-(methylamino)-N-(2-methylsulfanylethyl)quinoline-6-sulfonamide |
| SMILES | CNc1ccc2cc(S(=O)(=O)N(C)CCSC)ccc2n1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-15-14-7-4-11-10-12(5-6-13(11)16-14)21(18,19)17(2)8-9-20-3/h4-7,10H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | IDRHBLSQKVCKTJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |