C12H13F2N3O2S — CID 115408548
N-(2,2-difluoroethyl)-2-(methylamino)quinoline-6-sulfonamide (PubChem CID 115408548) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(methylamino)quinoline-6-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-2-(methylamino)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 115408548 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(methylamino)quinoline-6-sulfonamide |
| SMILES | CNc1ccc2cc(S(=O)(=O)NCC(F)F)ccc2n1 |
| InChI | InChI=1S/C12H13F2N3O2S/c1-15-12-5-2-8-6-9(3-4-10(8)17-12)20(18,19)16-7-11(13)14/h2-6,11,16H,7H2,1H3,(H,15,17) |
| InChIKey | FJJBRGJXGGOCFH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |