C12H15N5O3S — CID 43566345
2-[(2-hydrazinylquinolin-6-yl)sulfonylamino]-N-methylacetamide (PubChem CID 43566345) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[(2-hydrazinylquinolin-6-yl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(2-hydrazinylquinolin-6-yl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43566345 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-[(2-hydrazinylquinolin-6-yl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1ccc2nc(NN)ccc2c1 |
| InChI | InChI=1S/C12H15N5O3S/c1-14-12(18)7-15-21(19,20)9-3-4-10-8(6-9)2-5-11(16-10)17-13/h2-6,15H,7,13H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | XMAIPHSAGWNMQI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|