C11H19N5O3S — CID 115356564
N-tert-butyl-2-[(6-hydrazinyl-3-pyridinyl)sulfonylamino]acetamide (PubChem CID 115356564) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-tert-butyl-2-[(6-hydrazinyl-3-pyridinyl)sulfonylamino]acetamide.
| Compound Name | N-tert-butyl-2-[(6-hydrazinyl-3-pyridinyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 115356564 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-tert-butyl-2-[(6-hydrazinyl-3-pyridinyl)sulfonylamino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNS(=O)(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C11H19N5O3S/c1-11(2,3)15-10(17)7-14-20(18,19)8-4-5-9(16-12)13-6-8/h4-6,14H,7,12H2,1-3H3,(H,13,16)(H,15,17) |
| InChIKey | ZZUUNTATAULSTE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|