C11H20N4O2S — CID 63003893
6-hydrazinyl-N-(4-methylpentyl)pyridine-3-sulfonamide (PubChem CID 63003893) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-hydrazinyl-N-(4-methylpentyl)pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(4-methylpentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63003893 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-hydrazinyl-N-(4-methylpentyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CCCNS(=O)(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C11H20N4O2S/c1-9(2)4-3-7-14-18(16,17)10-5-6-11(15-12)13-8-10/h5-6,8-9,14H,3-4,7,12H2,1-2H3,(H,13,15) |
| InChIKey | CMMIXLSRVVLDGQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|