C12H22N4O2S — CID 62158260
N-[4-(dimethylamino)butyl]-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 62158260) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-[4-(dimethylamino)butyl]-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62158260 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NCCCCN(C)C)cn1 |
| InChI | InChI=1S/C12H22N4O2S/c1-13-12-7-6-11(10-14-12)19(17,18)15-8-4-5-9-16(2)3/h6-7,10,15H,4-5,8-9H2,1-3H3,(H,13,14) |
| InChIKey | ZXDVKKJIJHDQNY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|