C10H18N4O2S — CID 62145237
2-amino-N-[3-(dimethylamino)propyl]pyridine-4-sulfonamide (PubChem CID 62145237) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 62145237 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]pyridine-4-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C10H18N4O2S/c1-14(2)7-3-5-13-17(15,16)9-4-6-12-10(11)8-9/h4,6,8,13H,3,5,7H2,1-2H3,(H2,11,12) |
| InChIKey | ULJQBDJTYRYVEN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|