C10H18N4O4S2 — CID 106342326
N-[2-(dimethylsulfamoyl)ethyl]-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 106342326) has the molecular formula C10H18N4O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106342326 |
| Molecular Formula | C10H18N4O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NCCS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C10H18N4O4S2/c1-11-10-5-4-9(8-12-10)20(17,18)13-6-7-19(15,16)14(2)3/h4-5,8,13H,6-7H2,1-3H3,(H,11,12) |
| InChIKey | XIPLBDOVZADSIC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |