C11H20N4O4S2 — CID 63862617
N-[2-(methanesulfonamido)-2-methylpropyl]-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 63862617) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-2-methylpropyl]-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-[2-(methanesulfonamido)-2-methylpropyl]-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63862617 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[2-(methanesulfonamido)-2-methylpropyl]-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NCC(C)(C)NS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C11H20N4O4S2/c1-11(2,15-20(4,16)17)8-14-21(18,19)9-5-6-10(12-3)13-7-9/h5-7,14-15H,8H2,1-4H3,(H,12,13) |
| InChIKey | IQKQRQBFGVQHOG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |