C10H16ClN3O4S2 — CID 63864494
6-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-sulfonamide (PubChem CID 63864494) has the molecular formula C10H16ClN3O4S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 6-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63864494 |
| Molecular Formula | C10H16ClN3O4S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 6-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-sulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)c1ccc(Cl)nc1)NS(C)(=O)=O |
| InChI | InChI=1S/C10H16ClN3O4S2/c1-10(2,14-19(3,15)16)7-13-20(17,18)8-4-5-9(11)12-6-8/h4-6,13-14H,7H2,1-3H3 |
| InChIKey | PASYFYMJAQLZCQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|