C10H13ClN2O2S2 — CID 107271026
6-chloro-N-[(1-methylsulfanylcyclopropyl)methyl]pyridine-3-sulfonamide (PubChem CID 107271026) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 6-chloro-N-[(1-methylsulfanylcyclopropyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(1-methylsulfanylcyclopropyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107271026 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6-chloro-N-[(1-methylsulfanylcyclopropyl)methyl]pyridine-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C10H13ClN2O2S2/c1-16-10(4-5-10)7-13-17(14,15)8-2-3-9(11)12-6-8/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | DDUQOBLUQWBAHU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|