C11H18N4O2S2 — CID 114116657
6-hydrazinyl-N-[(1-methylsulfanylcyclobutyl)methyl]pyridine-3-sulfonamide (PubChem CID 114116657) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(1-methylsulfanylcyclobutyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-[(1-methylsulfanylcyclobutyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114116657 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-hydrazinyl-N-[(1-methylsulfanylcyclobutyl)methyl]pyridine-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2ccc(NN)nc2)CCC1 |
| InChI | InChI=1S/C11H18N4O2S2/c1-18-11(5-2-6-11)8-14-19(16,17)9-3-4-10(15-12)13-7-9/h3-4,7,14H,2,5-6,8,12H2,1H3,(H,13,15) |
| InChIKey | CSGBEVFQQONKHM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|