C12H14N4O2S2 — CID 107642114
6-hydrazinyl-N-(2-methylsulfanylphenyl)pyridine-3-sulfonamide (PubChem CID 107642114) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methylsulfanylphenyl)pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(2-methylsulfanylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107642114 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 6-hydrazinyl-N-(2-methylsulfanylphenyl)pyridine-3-sulfonamide |
| SMILES | CSc1ccccc1NS(=O)(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C12H14N4O2S2/c1-19-11-5-3-2-4-10(11)16-20(17,18)9-6-7-12(15-13)14-8-9/h2-8,16H,13H2,1H3,(H,14,15) |
| InChIKey | GAIITDZUINVRFV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|