C12H12F2N4O2S — CID 103586397
N-(2,5-difluoro-4-methylphenyl)-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 103586397) has the molecular formula C12H12F2N4O2S and a molecular weight of 314.32 g/mol. Its IUPAC name is N-(2,5-difluoro-4-methylphenyl)-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(2,5-difluoro-4-methylphenyl)-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103586397 |
| Molecular Formula | C12H12F2N4O2S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-(2,5-difluoro-4-methylphenyl)-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | Cc1cc(F)c(NS(=O)(=O)c2ccc(NN)nc2)cc1F |
| InChI | InChI=1S/C12H12F2N4O2S/c1-7-4-10(14)11(5-9(7)13)18-21(19,20)8-2-3-12(17-15)16-6-8/h2-6,18H,15H2,1H3,(H,16,17) |
| InChIKey | YPVVWTRSNRWXIK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|