C12H11BrFN3O2S — CID 62146982
N-(5-bromo-2-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 62146982) has the molecular formula C12H11BrFN3O2S and a molecular weight of 360.21 g/mol. Its IUPAC name is N-(5-bromo-2-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-(5-bromo-2-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62146982 |
| Molecular Formula | C12H11BrFN3O2S |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | N-(5-bromo-2-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)Nc2cc(Br)ccc2F)cn1 |
| InChI | InChI=1S/C12H11BrFN3O2S/c1-15-12-5-3-9(7-16-12)20(18,19)17-11-6-8(13)2-4-10(11)14/h2-7,17H,1H3,(H,15,16) |
| InChIKey | BMQPPMNHHQUYQZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |