C12H10Cl2FN3O2S — CID 107578094
N-(3,5-dichloro-4-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 107578094) has the molecular formula C12H10Cl2FN3O2S and a molecular weight of 350.20 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107578094 |
| Molecular Formula | C12H10Cl2FN3O2S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)Nc2cc(Cl)c(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C12H10Cl2FN3O2S/c1-16-11-3-2-8(6-17-11)21(19,20)18-7-4-9(13)12(15)10(14)5-7/h2-6,18H,1H3,(H,16,17) |
| InChIKey | SSRAWNXEUBJOGD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|