C11H6Cl3FN2O2S — CID 107573404
2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-4-sulfonamide (PubChem CID 107573404) has the molecular formula C11H6Cl3FN2O2S and a molecular weight of 355.61 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 107573404 |
| Molecular Formula | C11H6Cl3FN2O2S |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(F)c(Cl)c1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H6Cl3FN2O2S/c12-8-3-6(4-9(13)11(8)15)17-20(18,19)7-1-2-16-10(14)5-7/h1-5,17H |
| InChIKey | QCZQZYKHBKCLTK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|