C12H9ClF2N2O2S — CID 82819125
2-chloro-N-(2,6-difluoro-3-methylphenyl)pyridine-4-sulfonamide (PubChem CID 82819125) has the molecular formula C12H9ClF2N2O2S and a molecular weight of 318.73 g/mol. Its IUPAC name is 2-chloro-N-(2,6-difluoro-3-methylphenyl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(2,6-difluoro-3-methylphenyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 82819125 |
| Molecular Formula | C12H9ClF2N2O2S |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-chloro-N-(2,6-difluoro-3-methylphenyl)pyridine-4-sulfonamide |
| SMILES | Cc1ccc(F)c(NS(=O)(=O)c2ccnc(Cl)c2)c1F |
| InChI | InChI=1S/C12H9ClF2N2O2S/c1-7-2-3-9(14)12(11(7)15)17-20(18,19)8-4-5-16-10(13)6-8/h2-6,17H,1H3 |
| InChIKey | MJPJIBWDAXVNDZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|