C11H9BrClN3O2S — CID 79734611
N-(5-bromo-4-methyl-2-pyridinyl)-2-chloropyridine-4-sulfonamide (PubChem CID 79734611) has the molecular formula C11H9BrClN3O2S and a molecular weight of 362.64 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-2-chloropyridine-4-sulfonamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-chloropyridine-4-sulfonamide |
|---|---|
| PubChem CID | 79734611 |
| Molecular Formula | C11H9BrClN3O2S |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-chloropyridine-4-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccnc(Cl)c2)ncc1Br |
| InChI | InChI=1S/C11H9BrClN3O2S/c1-7-4-11(15-6-9(7)12)16-19(17,18)8-2-3-14-10(13)5-8/h2-6H,1H3,(H,15,16) |
| InChIKey | WGDSRIYVJPYVGI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|