C12H9BrCl2N2O2S — CID 79729132
N-(5-bromo-4-methyl-2-pyridinyl)-2,5-dichlorobenzenesulfonamide (PubChem CID 79729132) has the molecular formula C12H9BrCl2N2O2S and a molecular weight of 396.09 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 79729132 |
| Molecular Formula | C12H9BrCl2N2O2S |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 393.89 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-2,5-dichlorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Cl)ccc2Cl)ncc1Br |
| InChI | InChI=1S/C12H9BrCl2N2O2S/c1-7-4-12(16-6-9(7)13)17-20(18,19)11-5-8(14)2-3-10(11)15/h2-6H,1H3,(H,16,17) |
| InChIKey | SHFNAWFXTOVOCW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |