C13H13BrFN3O2S — CID 106070814
5-(aminomethyl)-N-(5-bromo-4-methyl-2-pyridinyl)-2-fluorobenzenesulfonamide (PubChem CID 106070814) has the molecular formula C13H13BrFN3O2S and a molecular weight of 374.24 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(5-bromo-4-methyl-2-pyridinyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-N-(5-bromo-4-methyl-2-pyridinyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106070814 |
| Molecular Formula | C13H13BrFN3O2S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 5-(aminomethyl)-N-(5-bromo-4-methyl-2-pyridinyl)-2-fluorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(CN)ccc2F)ncc1Br |
| InChI | InChI=1S/C13H13BrFN3O2S/c1-8-4-13(17-7-10(8)14)18-21(19,20)12-5-9(6-16)2-3-11(12)15/h2-5,7H,6,16H2,1H3,(H,17,18) |
| InChIKey | KBVXPAHKEIYOHK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |