C12H12Br2N4O2S — CID 79736645
5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 79736645) has the molecular formula C12H12Br2N4O2S and a molecular weight of 436.13 g/mol. Its IUPAC name is 5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79736645 |
| Molecular Formula | C12H12Br2N4O2S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | 5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)Nc1cc(C)c(Br)cn1 |
| InChI | InChI=1S/C12H12Br2N4O2S/c1-7-3-11(16-6-9(7)14)18-21(19,20)10-4-8(13)5-17-12(10)15-2/h3-6H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | CRRNHCPOFBXSBQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |