C11H12BrN5O2S — CID 79729890
N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 79729890) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 79729890 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2cc(C)c(Br)cn2)cn1 |
| InChI | InChI=1S/C11H12BrN5O2S/c1-7-3-10(14-6-9(7)12)17-20(18,19)8-4-15-11(13-2)16-5-8/h3-6H,1-2H3,(H,14,17)(H,13,15,16) |
| InChIKey | VPNJJOGZIRRSPW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |