C13H9BrFN3O2S — CID 79736144
N-(5-bromo-4-methyl-2-pyridinyl)-3-cyano-4-fluorobenzenesulfonamide (PubChem CID 79736144) has the molecular formula C13H9BrFN3O2S and a molecular weight of 370.20 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-3-cyano-4-fluorobenzenesulfonamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-3-cyano-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 79736144 |
| Molecular Formula | C13H9BrFN3O2S |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-3-cyano-4-fluorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(F)c(C#N)c2)ncc1Br |
| InChI | InChI=1S/C13H9BrFN3O2S/c1-8-4-13(17-7-11(8)14)18-21(19,20)10-2-3-12(15)9(5-10)6-16/h2-5,7H,1H3,(H,17,18) |
| InChIKey | UUMLEKONEMKMEC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |