C10H5ClFN3O2S2 — CID 59436522
N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-fluorobenzenesulfonamide (PubChem CID 59436522) has the molecular formula C10H5ClFN3O2S2 and a molecular weight of 317.75 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-fluorobenzenesulfonamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59436522 |
| Molecular Formula | C10H5ClFN3O2S2 |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-fluorobenzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2ncc(Cl)s2)ccc1F |
| InChI | InChI=1S/C10H5ClFN3O2S2/c11-9-5-14-10(18-9)15-19(16,17)7-1-2-8(12)6(3-7)4-13/h1-3,5H,(H,14,15) |
| InChIKey | QMTHPBLQWBHFNZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |