C18H20ClN5O2S2 — CID 118109023
N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide (PubChem CID 118109023) has the molecular formula C18H20ClN5O2S2 and a molecular weight of 437.98 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 118109023 |
| Molecular Formula | C18H20ClN5O2S2 |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-3-cyano-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2ncc(Cl)s2)ccc1NCC12CCCN1CCC2 |
| InChI | InChI=1S/C18H20ClN5O2S2/c19-16-11-21-17(27-16)23-28(25,26)14-3-4-15(13(9-14)10-20)22-12-18-5-1-7-24(18)8-2-6-18/h3-4,9,11,22H,1-2,5-8,12H2,(H,21,23) |
| InChIKey | KRIMYYLNENGOQX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |