C17H18ClF3N4O2S2 — CID 118109346
3-chloro-2-fluoro-4-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109346) has the molecular formula C17H18ClF3N4O2S2 and a molecular weight of 466.94 g/mol. Its IUPAC name is 3-chloro-2-fluoro-4-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-2-fluoro-4-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109346 |
| Molecular Formula | C17H18ClF3N4O2S2 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 3-chloro-2-fluoro-4-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(F)s1)c1ccc(NC[C@@]23CCCN2C[C@H](F)C3)c(Cl)c1F |
| InChI | InChI=1S/C17H18ClF3N4O2S2/c18-14-11(23-9-17-4-1-5-25(17)8-10(19)6-17)2-3-12(15(14)21)29(26,27)24-16-22-7-13(20)28-16/h2-3,7,10,23H,1,4-6,8-9H2,(H,22,24)/t10-,17+/m1/s1 |
| InChIKey | XKDYGLLLEPKANC-QGHHPUGFSA-N |
| XLogP | 3.86 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |