C24H26ClFN4O3S2 — CID 118109196
5-chloro-2-fluoro-4-[[(2S,8S)-2-(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109196) has the molecular formula C24H26ClFN4O3S2 and a molecular weight of 537.08 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[[(2S,8S)-2-(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[[(2S,8S)-2-(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109196 |
| Molecular Formula | C24H26ClFN4O3S2 |
| Molecular Weight | 537.08 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 5-chloro-2-fluoro-4-[[(2S,8S)-2-(4-methoxyphenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc([C@H]2CN3CCC[C@@]3(CNc3cc(F)c(S(=O)(=O)Nc4nccs4)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C24H26ClFN4O3S2/c1-33-18-5-3-16(4-6-18)17-13-24(7-2-9-30(24)14-17)15-28-21-12-20(26)22(11-19(21)25)35(31,32)29-23-27-8-10-34-23/h3-6,8,10-12,17,28H,2,7,9,13-15H2,1H3,(H,27,29)/t17-,24+/m1/s1 |
| InChIKey | LSRADDSFBYCDMT-OSPHWJPCSA-N |
| XLogP | 5.18 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |