C27H32ClFN4O4S2 — CID 118109109
4-[[(8aS)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methylamino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109109) has the molecular formula C27H32ClFN4O4S2 and a molecular weight of 595.16 g/mol. Its IUPAC name is 4-[[(8aS)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methylamino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(8aS)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methylamino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109109 |
| Molecular Formula | C27H32ClFN4O4S2 |
| Molecular Weight | 595.16 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 4-[[(8aS)-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methylamino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc(Cl)c(NC[C@@]34CCCCN3CCC4)cc2F)c(OC)c1 |
| InChI | InChI=1S/C27H32ClFN4O4S2/c1-36-20-7-6-19(24(14-20)37-2)17-33(26-30-10-13-38-26)39(34,35)25-15-21(28)23(16-22(25)29)31-18-27-8-3-4-11-32(27)12-5-9-27/h6-7,10,13-16,31H,3-5,8-9,11-12,17-18H2,1-2H3/t27-/m0/s1 |
| InChIKey | DHHNDYTWGUBBGP-MHZLTWQESA-N |
| XLogP | 5.78 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.16 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |