C27H30Cl3FN4O4S2 — CID 134429855
5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134429855) has the molecular formula C27H30Cl3FN4O4S2 and a molecular weight of 664.05 g/mol. Its IUPAC name is 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134429855 |
| Molecular Formula | C27H30Cl3FN4O4S2 |
| Molecular Weight | 664.05 g/mol |
| Exact Mass | 662.08 |
| IUPAC Name | 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc(Cl)c(N[C@@H]3C[C@@H]4[C@H](C[C@H]3N(C)C)C4(Cl)Cl)cc2F)c(OC)c1 |
| InChI | InChI=1S/C27H30Cl3FN4O4S2/c1-34(2)23-11-18-17(27(18,29)30)10-22(23)33-21-13-20(31)25(12-19(21)28)41(36,37)35(26-32-7-8-40-26)14-15-5-6-16(38-3)9-24(15)39-4/h5-9,12-13,17-18,22-23,33H,10-11,14H2,1-4H3/t17-,18+,22-,23-/m1/s1 |
| InChIKey | HFTWLYPBDZRDMA-AAUAJYIVSA-N |
| XLogP | 6.27 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.05 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|