C26H31ClF2N4O4S2 — CID 134429842
5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4R)-2-(dimethylamino)-4-fluorocyclohexyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134429842) has the molecular formula C26H31ClF2N4O4S2 and a molecular weight of 601.14 g/mol. Its IUPAC name is 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4R)-2-(dimethylamino)-4-fluorocyclohexyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4R)-2-(dimethylamino)-4-fluorocyclohexyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134429842 |
| Molecular Formula | C26H31ClF2N4O4S2 |
| Molecular Weight | 601.14 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4R)-2-(dimethylamino)-4-fluorocyclohexyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc(Cl)c(N[C@H]3CC[C@@H](F)C[C@@H]3N(C)C)cc2F)c(OC)c1 |
| InChI | InChI=1S/C26H31ClF2N4O4S2/c1-32(2)23-11-17(28)6-8-21(23)31-22-14-20(29)25(13-19(22)27)39(34,35)33(26-30-9-10-38-26)15-16-5-7-18(36-3)12-24(16)37-4/h5,7,9-10,12-14,17,21,23,31H,6,8,11,15H2,1-4H3/t17-,21+,23+/m1/s1 |
| InChIKey | NFJDBEALVHCQRA-FHZYATBESA-N |
| XLogP | 5.58 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.14 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |